C15H10N2O3S — CID 132501495
5-(2-nitrophenyl)-2-phenyl-1,3-thiazol-4-ol (PubChem CID 132501495) has the molecular formula C15H10N2O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-2-phenyl-1,3-thiazol-4-ol.
| Compound Name | 5-(2-nitrophenyl)-2-phenyl-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 132501495 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-(2-nitrophenyl)-2-phenyl-1,3-thiazol-4-ol |
| SMILES | O=[N+]([O-])c1ccccc1-c1sc(-c2ccccc2)nc1O |
| InChI | InChI=1S/C15H10N2O3S/c18-14-13(11-8-4-5-9-12(11)17(19)20)21-15(16-14)10-6-2-1-3-7-10/h1-9,18H |
| InChIKey | IPZAUMFNQRMOBV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|