C11H10N2O3S — CID 64544321
1-[2-(2-nitrophenyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 64544321) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 1-[2-(2-nitrophenyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(2-nitrophenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 64544321 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 1-[2-(2-nitrophenyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CC(O)c1csc(-c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H10N2O3S/c1-7(14)9-6-17-11(12-9)8-4-2-3-5-10(8)13(15)16/h2-7,14H,1H3 |
| InChIKey | SJDFUHJQMOBMKO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|