C11H8N2O3S — CID 62652991
1-[2-(2-nitrophenyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 62652991) has the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-[2-(2-nitrophenyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(2-nitrophenyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 62652991 |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 1-[2-(2-nitrophenyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(-c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H8N2O3S/c1-7(14)10-6-12-11(17-10)8-4-2-3-5-9(8)13(15)16/h2-6H,1H3 |
| InChIKey | SNDZUZCRRWMHLA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|