C11H8ClNOS — CID 1477653
1-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 1477653) has the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 1477653 |
| Molecular Formula | C11H8ClNOS |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C11H8ClNOS/c1-7(14)10-6-13-11(15-10)8-4-2-3-5-9(8)12/h2-6H,1H3 |
| InChIKey | FNYWYSJCUCVBCG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |