C16H10ClNOS — CID 3789019
[2-(4-chlorophenyl)-1,3-thiazol-5-yl]-phenylmethanone (PubChem CID 3789019) has the molecular formula C16H10ClNOS and a molecular weight of 299.78 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1,3-thiazol-5-yl]-phenylmethanone.
| Compound Name | [2-(4-chlorophenyl)-1,3-thiazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 3789019 |
| Molecular Formula | C16H10ClNOS |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | [2-(4-chlorophenyl)-1,3-thiazol-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cnc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C16H10ClNOS/c17-13-8-6-12(7-9-13)16-18-10-14(20-16)15(19)11-4-2-1-3-5-11/h1-10H |
| InChIKey | LSFVQNRVOSBHHU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |