C11H9ClFNOS — CID 64545128
1-[2-(3-chloro-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 64545128) has the molecular formula C11H9ClFNOS and a molecular weight of 257.72 g/mol. Its IUPAC name is 1-[2-(3-chloro-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(3-chloro-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 64545128 |
| Molecular Formula | C11H9ClFNOS |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 1-[2-(3-chloro-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CC(O)c1csc(-c2cccc(Cl)c2F)n1 |
| InChI | InChI=1S/C11H9ClFNOS/c1-6(15)9-5-16-11(14-9)7-3-2-4-8(12)10(7)13/h2-6,15H,1H3 |
| InChIKey | HGGCFBAOHHTZTG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |