C11H11FN2S — CID 95377650
(1R)-1-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 95377650) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is (1R)-1-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]ethanamine.
| Compound Name | (1R)-1-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 95377650 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (1R)-1-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | C[C@@H](N)c1csc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C11H11FN2S/c1-7(13)10-6-15-11(14-10)8-4-2-3-5-9(8)12/h2-7H,13H2,1H3/t7-/m1/s1 |
| InChIKey | LOOCUWMTACLEPC-SSDOTTSWSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |