C13H12N2S2 — CID 64542695
1-[2-(1-benzothiophen-3-yl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 64542695) has the molecular formula C13H12N2S2 and a molecular weight of 260.39 g/mol. Its IUPAC name is 1-[2-(1-benzothiophen-3-yl)-1,3-thiazol-4-yl]ethanamine.
| Compound Name | 1-[2-(1-benzothiophen-3-yl)-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 64542695 |
| Molecular Formula | C13H12N2S2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-[2-(1-benzothiophen-3-yl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | CC(N)c1csc(-c2csc3ccccc23)n1 |
| InChI | InChI=1S/C13H12N2S2/c1-8(14)11-7-17-13(15-11)10-6-16-12-5-3-2-4-9(10)12/h2-8H,14H2,1H3 |
| InChIKey | KHRZYQSQGJDBML-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |