C11H7BrN2S2 — CID 116864381
2-(1-benzothiophen-3-yl)-5-bromo-1,3-thiazol-4-amine (PubChem CID 116864381) has the molecular formula C11H7BrN2S2 and a molecular weight of 311.23 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-5-bromo-1,3-thiazol-4-amine.
| Compound Name | 2-(1-benzothiophen-3-yl)-5-bromo-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 116864381 |
| Molecular Formula | C11H7BrN2S2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-5-bromo-1,3-thiazol-4-amine |
| SMILES | Nc1nc(-c2csc3ccccc23)sc1Br |
| InChI | InChI=1S/C11H7BrN2S2/c12-9-10(13)14-11(16-9)7-5-15-8-4-2-1-3-6(7)8/h1-5H,13H2 |
| InChIKey | HDDHBAJVHSIBEU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |