C12H13BrN2S — CID 116864382
5-bromo-2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-amine (PubChem CID 116864382) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is 5-bromo-2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-amine.
| Compound Name | 5-bromo-2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 116864382 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 5-bromo-2-(2,3,4-trimethylphenyl)-1,3-thiazol-4-amine |
| SMILES | Cc1ccc(-c2nc(N)c(Br)s2)c(C)c1C |
| InChI | InChI=1S/C12H13BrN2S/c1-6-4-5-9(8(3)7(6)2)12-15-11(14)10(13)16-12/h4-5H,14H2,1-3H3 |
| InChIKey | PRPDYBVMIJBXDC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |