C10H9BrN2OS — CID 116864276
5-bromo-2-(4-methoxyphenyl)-1,3-thiazol-4-amine (PubChem CID 116864276) has the molecular formula C10H9BrN2OS and a molecular weight of 285.17 g/mol. Its IUPAC name is 5-bromo-2-(4-methoxyphenyl)-1,3-thiazol-4-amine.
| Compound Name | 5-bromo-2-(4-methoxyphenyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 116864276 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 5-bromo-2-(4-methoxyphenyl)-1,3-thiazol-4-amine |
| SMILES | COc1ccc(-c2nc(N)c(Br)s2)cc1 |
| InChI | InChI=1S/C10H9BrN2OS/c1-14-7-4-2-6(3-5-7)10-13-9(12)8(11)15-10/h2-5H,12H2,1H3 |
| InChIKey | YHTWZOCPQFLXSC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |