C12H13BrN2OS — CID 116864302
5-bromo-2-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-4-amine (PubChem CID 116864302) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is 5-bromo-2-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-4-amine.
| Compound Name | 5-bromo-2-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 116864302 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 5-bromo-2-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-4-amine |
| SMILES | COc1cc(C)c(-c2nc(N)c(Br)s2)cc1C |
| InChI | InChI=1S/C12H13BrN2OS/c1-6-5-9(16-3)7(2)4-8(6)12-15-11(14)10(13)17-12/h4-5H,14H2,1-3H3 |
| InChIKey | GYEJFKHZAHXJCA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |