C11H8N2OS — CID 116832461
4-(1-benzothiophen-3-yl)-1,3-oxazol-2-amine (PubChem CID 116832461) has the molecular formula C11H8N2OS and a molecular weight of 216.27 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-(1-benzothiophen-3-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116832461 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-1,3-oxazol-2-amine |
| SMILES | Nc1nc(-c2csc3ccccc23)co1 |
| InChI | InChI=1S/C11H8N2OS/c12-11-13-9(5-14-11)8-6-15-10-4-2-1-3-7(8)10/h1-6H,(H2,12,13) |
| InChIKey | MCUZZMCFOULANP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |