C21H14N4S — CID 68910536
6-(1-benzothiophen-3-yl)-4-phenylpyrido[3,2-d]pyrimidin-2-amine (PubChem CID 68910536) has the molecular formula C21H14N4S and a molecular weight of 354.44 g/mol. Its IUPAC name is 6-(1-benzothiophen-3-yl)-4-phenylpyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-(1-benzothiophen-3-yl)-4-phenylpyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68910536 |
| Molecular Formula | C21H14N4S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 6-(1-benzothiophen-3-yl)-4-phenylpyrido[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c2nc(-c3csc4ccccc34)ccc2n1 |
| InChI | InChI=1S/C21H14N4S/c22-21-24-17-11-10-16(15-12-26-18-9-5-4-8-14(15)18)23-20(17)19(25-21)13-6-2-1-3-7-13/h1-12H,(H2,22,24,25) |
| InChIKey | LIXCSGLXCVBESW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |