C24H22N4O2 — CID 68910825
tert-butyl 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate (PubChem CID 68910825) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is tert-butyl 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate.
| Compound Name | tert-butyl 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate |
|---|---|
| PubChem CID | 68910825 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | tert-butyl 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(-c2ccc3nc(N)nc(-c4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C24H22N4O2/c1-24(2,3)30-22(29)17-11-7-10-16(14-17)18-12-13-19-21(26-18)20(28-23(25)27-19)15-8-5-4-6-9-15/h4-14H,1-3H3,(H2,25,27,28) |
| InChIKey | DKUCBRROCVWYTQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |