C21H16N4O2 — CID 68916021
methyl 2-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate (PubChem CID 68916021) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is methyl 2-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate.
| Compound Name | methyl 2-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate |
|---|---|
| PubChem CID | 68916021 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl 2-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc2nc(N)nc(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C21H16N4O2/c1-27-20(26)15-10-6-5-9-14(15)16-11-12-17-19(23-16)18(25-21(22)24-17)13-7-3-2-4-8-13/h2-12H,1H3,(H2,22,24,25) |
| InChIKey | XIXMZPVZOBCRST-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |