C22H18N4O2 — CID 91440929
methyl 2-(2,4-diaminoquinazolin-6-yl)-3-phenylbenzoate (PubChem CID 91440929) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 2-(2,4-diaminoquinazolin-6-yl)-3-phenylbenzoate.
| Compound Name | methyl 2-(2,4-diaminoquinazolin-6-yl)-3-phenylbenzoate |
|---|---|
| PubChem CID | 91440929 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | methyl 2-(2,4-diaminoquinazolin-6-yl)-3-phenylbenzoate |
| SMILES | COC(=O)c1cccc(-c2ccccc2)c1-c1ccc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C22H18N4O2/c1-28-21(27)16-9-5-8-15(13-6-3-2-4-7-13)19(16)14-10-11-18-17(12-14)20(23)26-22(24)25-18/h2-12H,1H3,(H4,23,24,25,26) |
| InChIKey | KRLQZOJUSPVVLP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |