C23H19N5O3 — CID 68912338
4-[3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)anilino]-4-oxobutanoic acid (PubChem CID 68912338) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 4-[3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68912338 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-[3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)anilino]-4-oxobutanoic acid |
| SMILES | Nc1nc(-c2ccccc2)c2nc(-c3cccc(NC(=O)CCC(=O)O)c3)ccc2n1 |
| InChI | InChI=1S/C23H19N5O3/c24-23-27-18-10-9-17(26-22(18)21(28-23)14-5-2-1-3-6-14)15-7-4-8-16(13-15)25-19(29)11-12-20(30)31/h1-10,13H,11-12H2,(H,25,29)(H,30,31)(H2,24,27,28) |
| InChIKey | HIMORMQOILDJII-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |