C24H21N5O2 — CID 87622044
N-[4-(2-amino-4-benzylpyrido[3,2-d]pyrimidin-6-yl)phenyl]-4-oxobutanamide (PubChem CID 87622044) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is N-[4-(2-amino-4-benzylpyrido[3,2-d]pyrimidin-6-yl)phenyl]-4-oxobutanamide.
| Compound Name | N-[4-(2-amino-4-benzylpyrido[3,2-d]pyrimidin-6-yl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 87622044 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[4-(2-amino-4-benzylpyrido[3,2-d]pyrimidin-6-yl)phenyl]-4-oxobutanamide |
| SMILES | Nc1nc(Cc2ccccc2)c2nc(-c3ccc(NC(=O)CCC=O)cc3)ccc2n1 |
| InChI | InChI=1S/C24H21N5O2/c25-24-28-20-13-12-19(17-8-10-18(11-9-17)26-22(31)7-4-14-30)27-23(20)21(29-24)15-16-5-2-1-3-6-16/h1-3,5-6,8-14H,4,7,15H2,(H,26,31)(H2,25,28,29) |
| InChIKey | YEWUMZIGKUIELQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|