C18H18N6O3 — CID 24794545
N-[3-(2-amino-4-ethoxypteridin-6-yl)phenyl]-4-oxobutanamide (PubChem CID 24794545) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-[3-(2-amino-4-ethoxypteridin-6-yl)phenyl]-4-oxobutanamide.
| Compound Name | N-[3-(2-amino-4-ethoxypteridin-6-yl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 24794545 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[3-(2-amino-4-ethoxypteridin-6-yl)phenyl]-4-oxobutanamide |
| SMILES | CCOc1nc(N)nc2ncc(-c3cccc(NC(=O)CCC=O)c3)nc12 |
| InChI | InChI=1S/C18H18N6O3/c1-2-27-17-15-16(23-18(19)24-17)20-10-13(22-15)11-5-3-6-12(9-11)21-14(26)7-4-8-25/h3,5-6,8-10H,2,4,7H2,1H3,(H,21,26)(H2,19,20,23,24) |
| InChIKey | JJPLZZGRHJHQJW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 132.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|