C12H11N5O2 — CID 24794720
4-ethoxy-6-(furan-2-yl)pteridin-2-amine (PubChem CID 24794720) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-ethoxy-6-(furan-2-yl)pteridin-2-amine.
| Compound Name | 4-ethoxy-6-(furan-2-yl)pteridin-2-amine |
|---|---|
| PubChem CID | 24794720 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-ethoxy-6-(furan-2-yl)pteridin-2-amine |
| SMILES | CCOc1nc(N)nc2ncc(-c3ccco3)nc12 |
| InChI | InChI=1S/C12H11N5O2/c1-2-18-11-9-10(16-12(13)17-11)14-6-7(15-9)8-4-3-5-19-8/h3-6H,2H2,1H3,(H2,13,14,16,17) |
| InChIKey | SMTIGAWQYOYTPG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |