C11H11N7O — CID 68773249
4-ethoxy-6-(1H-pyrazol-5-yl)pteridin-2-amine (PubChem CID 68773249) has the molecular formula C11H11N7O and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-ethoxy-6-(1H-pyrazol-5-yl)pteridin-2-amine.
| Compound Name | 4-ethoxy-6-(1H-pyrazol-5-yl)pteridin-2-amine |
|---|---|
| PubChem CID | 68773249 |
| Molecular Formula | C11H11N7O |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-ethoxy-6-(1H-pyrazol-5-yl)pteridin-2-amine |
| SMILES | CCOc1nc(N)nc2ncc(-c3ccn[nH]3)nc12 |
| InChI | InChI=1S/C11H11N7O/c1-2-19-10-8-9(16-11(12)17-10)13-5-7(15-8)6-3-4-14-18-6/h3-5H,2H2,1H3,(H,14,18)(H2,12,13,16,17) |
| InChIKey | FYQYPAUIMMORIA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |