C16H15N5O3 — CID 68775176
methyl 3-(2-amino-4-ethoxypteridin-6-yl)benzoate (PubChem CID 68775176) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is methyl 3-(2-amino-4-ethoxypteridin-6-yl)benzoate.
| Compound Name | methyl 3-(2-amino-4-ethoxypteridin-6-yl)benzoate |
|---|---|
| PubChem CID | 68775176 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | methyl 3-(2-amino-4-ethoxypteridin-6-yl)benzoate |
| SMILES | CCOc1nc(N)nc2ncc(-c3cccc(C(=O)OC)c3)nc12 |
| InChI | InChI=1S/C16H15N5O3/c1-3-24-14-12-13(20-16(17)21-14)18-8-11(19-12)9-5-4-6-10(7-9)15(22)23-2/h4-8H,3H2,1-2H3,(H2,17,18,20,21) |
| InChIKey | IXEWTFUEHJLCOP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |