C12H13N7O — CID 68774809
4-ethoxy-6-(1-methylpyrazol-4-yl)pteridin-2-amine (PubChem CID 68774809) has the molecular formula C12H13N7O and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-ethoxy-6-(1-methylpyrazol-4-yl)pteridin-2-amine.
| Compound Name | 4-ethoxy-6-(1-methylpyrazol-4-yl)pteridin-2-amine |
|---|---|
| PubChem CID | 68774809 |
| Molecular Formula | C12H13N7O |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-ethoxy-6-(1-methylpyrazol-4-yl)pteridin-2-amine |
| SMILES | CCOc1nc(N)nc2ncc(-c3cnn(C)c3)nc12 |
| InChI | InChI=1S/C12H13N7O/c1-3-20-11-9-10(17-12(13)18-11)14-5-8(16-9)7-4-15-19(2)6-7/h4-6H,3H2,1-2H3,(H2,13,14,17,18) |
| InChIKey | MRGPXJWFLUKZSH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |