C30H30N10O4 — CID 160631661
4-(2-amino-4-ethoxypteridin-6-yl)phenol;4-ethoxy-6-(2-ethoxyphenyl)pteridin-2-amine (PubChem CID 160631661) has the molecular formula C30H30N10O4 and a molecular weight of 594.64 g/mol. Its IUPAC name is 4-(2-amino-4-ethoxypteridin-6-yl)phenol;4-ethoxy-6-(2-ethoxyphenyl)pteridin-2-amine.
| Compound Name | 4-(2-amino-4-ethoxypteridin-6-yl)phenol;4-ethoxy-6-(2-ethoxyphenyl)pteridin-2-amine |
|---|---|
| PubChem CID | 160631661 |
| Molecular Formula | C30H30N10O4 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | 4-(2-amino-4-ethoxypteridin-6-yl)phenol;4-ethoxy-6-(2-ethoxyphenyl)pteridin-2-amine |
| SMILES | CCOc1ccccc1-c1cnc2nc(N)nc(OCC)c2n1.CCOc1nc(N)nc2ncc(-c3ccc(O)cc3)nc12 |
| InChI | InChI=1S/C16H17N5O2.C14H13N5O2/c1-3-22-12-8-6-5-7-10(12)11-9-18-14-13(19-11)15(23-4-2)21-16(17)20-14;1-2-21-13-11-12(18-14(15)19-13)16-7-10(17-11)8-3-5-9(20)6-4-8/h5-9H,3-4H2,1-2H3,(H2,17,18,20,21);3-7,20H,2H2,1H3,(H2,15,16,18,19) |
| InChIKey | RHZOQWAQOBZGGM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 203.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |