C12H11N5OS — CID 11300268
4-ethoxy-6-thiophen-3-ylpteridin-2-amine (PubChem CID 11300268) has the molecular formula C12H11N5OS and a molecular weight of 273.32 g/mol. Its IUPAC name is 4-ethoxy-6-thiophen-3-ylpteridin-2-amine.
| Compound Name | 4-ethoxy-6-thiophen-3-ylpteridin-2-amine |
|---|---|
| PubChem CID | 11300268 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-ethoxy-6-thiophen-3-ylpteridin-2-amine |
| SMILES | CCOc1nc(N)nc2ncc(-c3ccsc3)nc12 |
| InChI | InChI=1S/C12H11N5OS/c1-2-18-11-9-10(16-12(13)17-11)14-5-8(15-9)7-3-4-19-6-7/h3-6H,2H2,1H3,(H2,13,14,16,17) |
| InChIKey | VIPCGCMUCBFPSP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |