C20H18ClN5O2 — CID 68651465
3-amino-6-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-N-methylpyrazine-2-carboxamide (PubChem CID 68651465) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 3-amino-6-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-N-methylpyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 68651465 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3-amino-6-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-N-methylpyrazine-2-carboxamide |
| SMILES | CNC(=O)c1nc(-c2cccc(NC(=O)Cc3ccc(Cl)cc3)c2)cnc1N |
| InChI | InChI=1S/C20H18ClN5O2/c1-23-20(28)18-19(22)24-11-16(26-18)13-3-2-4-15(10-13)25-17(27)9-12-5-7-14(21)8-6-12/h2-8,10-11H,9H2,1H3,(H2,22,24)(H,23,28)(H,25,27) |
| InChIKey | BWPHFCDVOXHHQI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |