C23H25N5O2 — CID 68820915
3-amino-N-methyl-6-[3-[[(4-propylbenzoyl)amino]methyl]phenyl]pyrazine-2-carboxamide (PubChem CID 68820915) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 3-amino-N-methyl-6-[3-[[(4-propylbenzoyl)amino]methyl]phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-methyl-6-[3-[[(4-propylbenzoyl)amino]methyl]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 68820915 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-amino-N-methyl-6-[3-[[(4-propylbenzoyl)amino]methyl]phenyl]pyrazine-2-carboxamide |
| SMILES | CCCc1ccc(C(=O)NCc2cccc(-c3cnc(N)c(C(=O)NC)n3)c2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-3-5-15-8-10-17(11-9-15)22(29)27-13-16-6-4-7-18(12-16)19-14-26-21(24)20(28-19)23(30)25-2/h4,6-12,14H,3,5,13H2,1-2H3,(H2,24,26)(H,25,30)(H,27,29) |
| InChIKey | LHANIJORFZVCQE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |