C26H26N6O2 — CID 142827356
3-amino-6-[3-[[3-[(3Z)-4-(ethylideneamino)buta-1,3-dien-2-yl]phenyl]methylcarbamoyl]phenyl]-N-methylpyrazine-2-carboxamide (PubChem CID 142827356) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-amino-6-[3-[[3-[(3Z)-4-(ethylideneamino)buta-1,3-dien-2-yl]phenyl]methylcarbamoyl]phenyl]-N-methylpyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[3-[[3-[(3Z)-4-(ethylideneamino)buta-1,3-dien-2-yl]phenyl]methylcarbamoyl]phenyl]-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142827356 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 3-amino-6-[3-[[3-[(3Z)-4-(ethylideneamino)buta-1,3-dien-2-yl]phenyl]methylcarbamoyl]phenyl]-N-methylpyrazine-2-carboxamide |
| SMILES | C=C(/C=C\N=C\C)c1cccc(CNC(=O)c2cccc(-c3cnc(N)c(C(=O)NC)n3)c2)c1 |
| InChI | InChI=1S/C26H26N6O2/c1-4-29-12-11-17(2)19-8-5-7-18(13-19)15-31-25(33)21-10-6-9-20(14-21)22-16-30-24(27)23(32-22)26(34)28-3/h4-14,16H,2,15H2,1,3H3,(H2,27,30)(H,28,34)(H,31,33)/b12-11-,29-4+ |
| InChIKey | CBZYETBZPOYMHY-MSJSGIRZSA-N |
| XLogP | 3.63 |
| TPSA | 122.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|