C25H25ClN8O — CID 110194603
4-[2-amino-6-(4-chlorophenyl)pteridin-4-yl]-N-(3-ethylphenyl)piperazine-1-carboxamide (PubChem CID 110194603) has the molecular formula C25H25ClN8O and a molecular weight of 488.98 g/mol. Its IUPAC name is 4-[2-amino-6-(4-chlorophenyl)pteridin-4-yl]-N-(3-ethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-amino-6-(4-chlorophenyl)pteridin-4-yl]-N-(3-ethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110194603 |
| Molecular Formula | C25H25ClN8O |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 4-[2-amino-6-(4-chlorophenyl)pteridin-4-yl]-N-(3-ethylphenyl)piperazine-1-carboxamide |
| SMILES | CCc1cccc(NC(=O)N2CCN(c3nc(N)nc4ncc(-c5ccc(Cl)cc5)nc34)CC2)c1 |
| InChI | InChI=1S/C25H25ClN8O/c1-2-16-4-3-5-19(14-16)29-25(35)34-12-10-33(11-13-34)23-21-22(31-24(27)32-23)28-15-20(30-21)17-6-8-18(26)9-7-17/h3-9,14-15H,2,10-13H2,1H3,(H,29,35)(H2,27,28,31,32) |
| InChIKey | YDIBNTKAGVJVDO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |