C15H20N4O3 — CID 126815827
1-N-(3-ethylphenyl)pyrrolidine-1,3,4-tricarboxamide (PubChem CID 126815827) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-N-(3-ethylphenyl)pyrrolidine-1,3,4-tricarboxamide.
| Compound Name | 1-N-(3-ethylphenyl)pyrrolidine-1,3,4-tricarboxamide |
|---|---|
| PubChem CID | 126815827 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-N-(3-ethylphenyl)pyrrolidine-1,3,4-tricarboxamide |
| SMILES | CCc1cccc(NC(=O)N2CC(C(N)=O)C(C(N)=O)C2)c1 |
| InChI | InChI=1S/C15H20N4O3/c1-2-9-4-3-5-10(6-9)18-15(22)19-7-11(13(16)20)12(8-19)14(17)21/h3-6,11-12H,2,7-8H2,1H3,(H2,16,20)(H2,17,21)(H,18,22) |
| InChIKey | PTKZPKXBDCFBGB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |