C17H26N4O — CID 98743883
(9aS)-N-(3-ethylphenyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 98743883) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is (9aS)-N-(3-ethylphenyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (9aS)-N-(3-ethylphenyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 98743883 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (9aS)-N-(3-ethylphenyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CCc1cccc(NC(=O)N2CCN3CCN(C)C[C@H]3C2)c1 |
| InChI | InChI=1S/C17H26N4O/c1-3-14-5-4-6-15(11-14)18-17(22)21-10-9-20-8-7-19(2)12-16(20)13-21/h4-6,11,16H,3,7-10,12-13H2,1-2H3,(H,18,22)/t16-/m0/s1 |
| InChIKey | IDBYABUSAWAWOH-INIZCTEOSA-N |
| XLogP | 1.71 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |