C22H26N8O2 — CID 68777874
[3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 68777874) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is [3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 68777874 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | [3-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc(-c3cnc4nc(N)nc(N5CCOCC5)c4n3)c2)CC1 |
| InChI | InChI=1S/C22H26N8O2/c1-28-5-7-30(8-6-28)21(31)16-4-2-3-15(13-16)17-14-24-19-18(25-17)20(27-22(23)26-19)29-9-11-32-12-10-29/h2-4,13-14H,5-12H2,1H3,(H2,23,24,26,27) |
| InChIKey | HBKIYDFZJCOMEC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |