C15H16N8O2 — CID 68775912
6-(2-methoxypyrimidin-5-yl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 68775912) has the molecular formula C15H16N8O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 6-(2-methoxypyrimidin-5-yl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(2-methoxypyrimidin-5-yl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 68775912 |
| Molecular Formula | C15H16N8O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-(2-methoxypyrimidin-5-yl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | COc1ncc(-c2cnc3nc(N)nc(N4CCOCC4)c3n2)cn1 |
| InChI | InChI=1S/C15H16N8O2/c1-24-15-18-6-9(7-19-15)10-8-17-12-11(20-10)13(22-14(16)21-12)23-2-4-25-5-3-23/h6-8H,2-5H2,1H3,(H2,16,17,21,22) |
| InChIKey | FUBZDVQDHYPUMV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |