C17H19N7O3 — CID 68776672
6-(2,6-dimethoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 68776672) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is 6-(2,6-dimethoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(2,6-dimethoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 68776672 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 6-(2,6-dimethoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCOCC4)c3n2)c(OC)n1 |
| InChI | InChI=1S/C17H19N7O3/c1-25-12-4-3-10(16(21-12)26-2)11-9-19-14-13(20-11)15(23-17(18)22-14)24-5-7-27-8-6-24/h3-4,9H,5-8H2,1-2H3,(H2,18,19,22,23) |
| InChIKey | BQSOFDRRDCTSHW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |