C19H18N6O2 — CID 68773160
5-(2-amino-4-morpholin-4-ylpteridin-6-yl)-2,3-dihydroinden-1-one (PubChem CID 68773160) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 5-(2-amino-4-morpholin-4-ylpteridin-6-yl)-2,3-dihydroinden-1-one.
| Compound Name | 5-(2-amino-4-morpholin-4-ylpteridin-6-yl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 68773160 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 5-(2-amino-4-morpholin-4-ylpteridin-6-yl)-2,3-dihydroinden-1-one |
| SMILES | Nc1nc(N2CCOCC2)c2nc(-c3ccc4c(c3)CCC4=O)cnc2n1 |
| InChI | InChI=1S/C19H18N6O2/c20-19-23-17-16(18(24-19)25-5-7-27-8-6-25)22-14(10-21-17)12-1-3-13-11(9-12)2-4-15(13)26/h1,3,9-10H,2,4-8H2,(H2,20,21,23,24) |
| InChIKey | UKMUYHRWINLNHC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |