C19H23N9O — CID 68774659
4-morpholin-4-yl-6-(6-piperazin-1-yl-3-pyridinyl)pteridin-2-amine (PubChem CID 68774659) has the molecular formula C19H23N9O and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-(6-piperazin-1-yl-3-pyridinyl)pteridin-2-amine.
| Compound Name | 4-morpholin-4-yl-6-(6-piperazin-1-yl-3-pyridinyl)pteridin-2-amine |
|---|---|
| PubChem CID | 68774659 |
| Molecular Formula | C19H23N9O |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 4-morpholin-4-yl-6-(6-piperazin-1-yl-3-pyridinyl)pteridin-2-amine |
| SMILES | Nc1nc(N2CCOCC2)c2nc(-c3ccc(N4CCNCC4)nc3)cnc2n1 |
| InChI | InChI=1S/C19H23N9O/c20-19-25-17-16(18(26-19)28-7-9-29-10-8-28)24-14(12-23-17)13-1-2-15(22-11-13)27-5-3-21-4-6-27/h1-2,11-12,21H,3-10H2,(H2,20,23,25,26) |
| InChIKey | NWMNLRYLMVICPA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |