C15H16N6O2 — CID 68775571
6-(5-methylfuran-2-yl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 68775571) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 6-(5-methylfuran-2-yl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(5-methylfuran-2-yl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 68775571 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 6-(5-methylfuran-2-yl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | Cc1ccc(-c2cnc3nc(N)nc(N4CCOCC4)c3n2)o1 |
| InChI | InChI=1S/C15H16N6O2/c1-9-2-3-11(23-9)10-8-17-13-12(18-10)14(20-15(16)19-13)21-4-6-22-7-5-21/h2-3,8H,4-7H2,1H3,(H2,16,17,19,20) |
| InChIKey | NYKUQOPLRQFGJB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |