C17H19N7O — CID 24794998
6-(4-amino-2-methylphenyl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 24794998) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 6-(4-amino-2-methylphenyl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(4-amino-2-methylphenyl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 24794998 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 6-(4-amino-2-methylphenyl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | Cc1cc(N)ccc1-c1cnc2nc(N)nc(N3CCOCC3)c2n1 |
| InChI | InChI=1S/C17H19N7O/c1-10-8-11(18)2-3-12(10)13-9-20-15-14(21-13)16(23-17(19)22-15)24-4-6-25-7-5-24/h2-3,8-9H,4-7,18H2,1H3,(H2,19,20,22,23) |
| InChIKey | LGQIZDUECUNZTF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|