C16H17N7O2 — CID 68776110
6-(6-methoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 68776110) has the molecular formula C16H17N7O2 and a molecular weight of 339.36 g/mol. Its IUPAC name is 6-(6-methoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(6-methoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 68776110 |
| Molecular Formula | C16H17N7O2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 6-(6-methoxy-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCOCC4)c3n2)cn1 |
| InChI | InChI=1S/C16H17N7O2/c1-24-12-3-2-10(8-18-12)11-9-19-14-13(20-11)15(22-16(17)21-14)23-4-6-25-7-5-23/h2-3,8-9H,4-7H2,1H3,(H2,17,19,21,22) |
| InChIKey | JNYPXMXHIINKJA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |