C16H16FN7O — CID 68779083
6-(6-fluoro-5-methyl-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 68779083) has the molecular formula C16H16FN7O and a molecular weight of 341.35 g/mol. Its IUPAC name is 6-(6-fluoro-5-methyl-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(6-fluoro-5-methyl-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 68779083 |
| Molecular Formula | C16H16FN7O |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-(6-fluoro-5-methyl-3-pyridinyl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | Cc1cc(-c2cnc3nc(N)nc(N4CCOCC4)c3n2)cnc1F |
| InChI | InChI=1S/C16H16FN7O/c1-9-6-10(7-19-13(9)17)11-8-20-14-12(21-11)15(23-16(18)22-14)24-2-4-25-5-3-24/h6-8H,2-5H2,1H3,(H2,18,20,22,23) |
| InChIKey | OEEFANGZSGUSKH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|