C21H23N7O3 — CID 68775123
[4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 68775123) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is [4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 68775123 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [4-(2-amino-4-morpholin-4-ylpteridin-6-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | Nc1nc(N2CCOCC2)c2nc(-c3ccc(C(=O)N4CCOCC4)cc3)cnc2n1 |
| InChI | InChI=1S/C21H23N7O3/c22-21-25-18-17(19(26-21)27-5-9-30-10-6-27)24-16(13-23-18)14-1-3-15(4-2-14)20(29)28-7-11-31-12-8-28/h1-4,13H,5-12H2,(H2,22,23,25,26) |
| InChIKey | AFECKDKDORPZBL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |