C17H16N6O3 — CID 11175594
6-(1,3-benzodioxol-5-yl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 11175594) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 11175594 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | Nc1nc(N2CCOCC2)c2nc(-c3ccc4c(c3)OCO4)cnc2n1 |
| InChI | InChI=1S/C17H16N6O3/c18-17-21-15-14(16(22-17)23-3-5-24-6-4-23)20-11(8-19-15)10-1-2-12-13(7-10)26-9-25-12/h1-2,7-8H,3-6,9H2,(H2,18,19,21,22) |
| InChIKey | GEGZTWCRDXHBJW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |