C25H20Cl3N7O — CID 110194643
(E)-1-[4-[2-amino-6-(2,4-dichlorophenyl)pteridin-4-yl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one (PubChem CID 110194643) has the molecular formula C25H20Cl3N7O and a molecular weight of 540.84 g/mol. Its IUPAC name is (E)-1-[4-[2-amino-6-(2,4-dichlorophenyl)pteridin-4-yl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-amino-6-(2,4-dichlorophenyl)pteridin-4-yl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 110194643 |
| Molecular Formula | C25H20Cl3N7O |
| Molecular Weight | 540.84 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | (E)-1-[4-[2-amino-6-(2,4-dichlorophenyl)pteridin-4-yl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one |
| SMILES | Nc1nc(N2CCN(C(=O)/C=C/c3ccc(Cl)cc3)CC2)c2nc(-c3ccc(Cl)cc3Cl)cnc2n1 |
| InChI | InChI=1S/C25H20Cl3N7O/c26-16-4-1-15(2-5-16)3-8-21(36)34-9-11-35(12-10-34)24-22-23(32-25(29)33-24)30-14-20(31-22)18-7-6-17(27)13-19(18)28/h1-8,13-14H,9-12H2,(H2,29,30,32,33)/b8-3+ |
| InChIKey | QHJBFJPFLRZCCI-FPYGCLRLSA-N |
| XLogP | 4.99 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|