C19H20Cl2N4O3S — CID 55993904
4-[3-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide (PubChem CID 55993904) has the molecular formula C19H20Cl2N4O3S and a molecular weight of 455.37 g/mol. Its IUPAC name is 4-[3-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-[3-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55993904 |
| Molecular Formula | C19H20Cl2N4O3S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 4-[3-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C=CC(=O)N2CCN(c3ncc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H20Cl2N4O3S/c1-22-29(27,28)16-5-2-14(3-6-16)4-7-18(26)24-8-10-25(11-9-24)19-17(21)12-15(20)13-23-19/h2-7,12-13,22H,8-11H2,1H3 |
| InChIKey | JJQROGHVRSSNCS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|