C26H26ClN3O3S — CID 169372116
N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 169372116) has the molecular formula C26H26ClN3O3S and a molecular weight of 496.03 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169372116 |
| Molecular Formula | C26H26ClN3O3S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCN(C(=O)C=Cc4ccccc4)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C26H26ClN3O3S/c1-20-7-11-23(12-8-20)34(32,33)28-22-10-13-25(24(27)19-22)29-15-17-30(18-16-29)26(31)14-9-21-5-3-2-4-6-21/h2-14,19,28H,15-18H2,1H3 |
| InChIKey | MOBWONNCXIMBDR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|