C25H22Cl2N4O2 — CID 17354459
2-chloro-N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]pyridine-3-carboxamide (PubChem CID 17354459) has the molecular formula C25H22Cl2N4O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is 2-chloro-N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17354459 |
| Molecular Formula | C25H22Cl2N4O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-chloro-N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)c(Cl)c1)c1cccnc1Cl |
| InChI | InChI=1S/C25H22Cl2N4O2/c26-21-17-19(29-25(33)20-7-4-12-28-24(20)27)9-10-22(21)30-13-15-31(16-14-30)23(32)11-8-18-5-2-1-3-6-18/h1-12,17H,13-16H2,(H,29,33)/b11-8+ |
| InChIKey | JDYYYSNDEKZCCU-DHZHZOJOSA-N |
| XLogP | 5.00 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|