C27H25Cl2N3O2S — CID 71949601
N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 71949601) has the molecular formula C27H25Cl2N3O2S and a molecular weight of 526.49 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 71949601 |
| Molecular Formula | C27H25Cl2N3O2S |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | N-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1ccc(N2CCN(C(=O)C=Cc3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C27H25Cl2N3O2S/c28-21-7-10-23(11-8-21)35-19-26(33)30-22-9-12-25(24(29)18-22)31-14-16-32(17-15-31)27(34)13-6-20-4-2-1-3-5-20/h1-13,18H,14-17,19H2,(H,30,33) |
| InChIKey | AGGVFGQVIKUHNE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|