C27H29ClN4O5 — CID 168563563
methyl 4-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168563563) has the molecular formula C27H29ClN4O5 and a molecular weight of 525.01 g/mol. Its IUPAC name is methyl 4-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168563563 |
| Molecular Formula | C27H29ClN4O5 |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | methyl 4-[3-chloro-4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(N3CCN(C(=O)C=Cc4ccccc4)CC3)c(Cl)c2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C27H29ClN4O5/c1-37-27(36)21-18-32(15-16-33)26(35)25(21)29-20-8-9-23(22(28)17-20)30-11-13-31(14-12-30)24(34)10-7-19-5-3-2-4-6-19/h2-10,17,29,33H,11-16,18H2,1H3 |
| InChIKey | IYWHPURWBMRYNZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|