C33H30N2O4 — CID 168561735
methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-tritylanilino)-2H-pyrrole-3-carboxylate (PubChem CID 168561735) has the molecular formula C33H30N2O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-tritylanilino)-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-tritylanilino)-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561735 |
| Molecular Formula | C33H30N2O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-tritylanilino)-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C33H30N2O4/c1-39-32(38)29-23-35(21-22-36)31(37)30(29)34-28-19-17-27(18-20-28)33(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-20,34,36H,21-23H2,1H3 |
| InChIKey | IJMHUFGAVFPITQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|